C28H26N5O2+ — CID 102227481
9-(diethylamino)-5-[1-(2-hydroxyethyl)pyridin-1-ium-3-yl]iminobenzo[a]phenoxazine-3-carbonitrile (PubChem CID 102227481) has the molecular formula C28H26N5O2+ and a molecular weight of 464.55 g/mol. Its IUPAC name is 9-(diethylamino)-5-[1-(2-hydroxyethyl)pyridin-1-ium-3-yl]iminobenzo[a]phenoxazine-3-carbonitrile.
| Compound Name | 9-(diethylamino)-5-[1-(2-hydroxyethyl)pyridin-1-ium-3-yl]iminobenzo[a]phenoxazine-3-carbonitrile |
|---|---|
| PubChem CID | 102227481 |
| Molecular Formula | C28H26N5O2+ |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 9-(diethylamino)-5-[1-(2-hydroxyethyl)pyridin-1-ium-3-yl]iminobenzo[a]phenoxazine-3-carbonitrile |
| SMILES | CCN(CC)c1ccc2nc3c4ccc(C#N)cc4/c(=N/c4ccc[n+](CCO)c4)cc-3oc2c1 |
| InChI | InChI=1S/C28H26N5O2/c1-3-33(4-2)21-8-10-24-26(15-21)35-27-16-25(30-20-6-5-11-32(18-20)12-13-34)23-14-19(17-29)7-9-22(23)28(27)31-24/h5-11,14-16,18,34H,3-4,12-13H2,1-2H3/q+1/b30-25+ |
| InChIKey | VTJOIZKRCQIDCH-QCWLDUFUSA-N |
| XLogP | 4.32 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|