About CID 102229371
CID 102229371 (PubChem CID 102229371) has the molecular formula C4BN4
and a molecular weight of 114.88 g/mol.
Molecular Properties
| Compound Name | CID 102229371 |
| PubChem CID | 102229371 |
| Molecular Formula | C4BN4 |
| Molecular Weight | 114.88 g/mol |
| Exact Mass | 115.02 |
| IUPAC Name | — |
| SMILES | N#CC1=N[B]N=C1C#N |
| InChI | InChI=1S/C4BN4/c6-1-3-4(2-7)9-5-8-3 |
| InChIKey | ADISCOLDRSVOPO-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.88 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 102229371 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102229371?
The IUPAC name of CID 102229371 (CID 102229371) is not available.
What is the SMILES notation for CID 102229371?
The canonical SMILES for CID 102229371 is N#CC1=N[B]N=C1C#N.
What is the InChIKey of CID 102229371?
The InChIKey is ADISCOLDRSVOPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4BN4/c6-1-3-4(2-7)9-5-8-3.
What are the key properties of CID 102229371?
CID 102229371 has a molecular weight of 114.88 g/mol, XLogP of -0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102229371 is sourced from PubChem (CID 102229371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).