C4H3N3O — CID 141438701
4-oxo-1,5-dihydropyrazole-3-carbonitrile (PubChem CID 141438701) has the molecular formula C4H3N3O and a molecular weight of 109.09 g/mol. Its IUPAC name is 4-oxo-1,5-dihydropyrazole-3-carbonitrile.
| Compound Name | 4-oxo-1,5-dihydropyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 141438701 |
| Molecular Formula | C4H3N3O |
| Molecular Weight | 109.09 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | 4-oxo-1,5-dihydropyrazole-3-carbonitrile |
| SMILES | N#CC1=NNCC1=O |
| InChI | InChI=1S/C4H3N3O/c5-1-3-4(8)2-6-7-3/h6H,2H2 |
| InChIKey | FULFKSYKJWABCV-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.09 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'} |
|---|