About CID 137254096
CID 137254096 (PubChem CID 137254096) has the molecular formula C5BN4O
and a molecular weight of 142.89 g/mol.
Molecular Properties
| Compound Name | CID 137254096 |
| PubChem CID | 137254096 |
| Molecular Formula | C5BN4O |
| Molecular Weight | 142.89 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | — |
| SMILES | N#CC1=N[B]N=C(C#N)C1=O |
| InChI | InChI=1S/C5BN4O/c7-1-3-5(11)4(2-8)10-6-9-3 |
| InChIKey | SVUYCWYLDFDNAG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 89.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.89 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 137254096 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137254096?
The IUPAC name of CID 137254096 (CID 137254096) is not available.
What is the SMILES notation for CID 137254096?
The canonical SMILES for CID 137254096 is N#CC1=N[B]N=C(C#N)C1=O.
What is the InChIKey of CID 137254096?
The InChIKey is SVUYCWYLDFDNAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5BN4O/c7-1-3-5(11)4(2-8)10-6-9-3.
What are the key properties of CID 137254096?
CID 137254096 has a molecular weight of 142.89 g/mol, XLogP of -0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137254096 is sourced from PubChem (CID 137254096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).