C22H31IO4 — CID 102229479
(2R,3S,4R,6R)-6-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-iodo-3-methyl-2-(2-phenylmethoxyethyl)oxane (PubChem CID 102229479) has the molecular formula C22H31IO4 and a molecular weight of 486.39 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-iodo-3-methyl-2-(2-phenylmethoxyethyl)oxane.
| Compound Name | (2R,3S,4R,6R)-6-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-iodo-3-methyl-2-(2-phenylmethoxyethyl)oxane |
|---|---|
| PubChem CID | 102229479 |
| Molecular Formula | C22H31IO4 |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | (2R,3S,4R,6R)-6-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-iodo-3-methyl-2-(2-phenylmethoxyethyl)oxane |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@H]1C[C@@H](I)[C@@H](C)[C@@H](CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C22H31IO4/c1-5-18-21(27-22(3,4)26-18)20-13-17(23)15(2)19(25-20)11-12-24-14-16-9-7-6-8-10-16/h5-10,15,17-21H,1,11-14H2,2-4H3/t15-,17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | MHRFBROISQCYSA-JRAOJMNRSA-N |
| XLogP | 4.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|