C8H9N3O3 — CID 102234725
(3S,4S)-3-azido-4-(furan-2-yl)-4-hydroxybutan-2-one (PubChem CID 102234725) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is (3S,4S)-3-azido-4-(furan-2-yl)-4-hydroxybutan-2-one.
| Compound Name | (3S,4S)-3-azido-4-(furan-2-yl)-4-hydroxybutan-2-one |
|---|---|
| PubChem CID | 102234725 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (3S,4S)-3-azido-4-(furan-2-yl)-4-hydroxybutan-2-one |
| SMILES | CC(=O)[C@@H](N=[N+]=[N-])[C@H](O)c1ccco1 |
| InChI | InChI=1S/C8H9N3O3/c1-5(12)7(10-11-9)8(13)6-3-2-4-14-6/h2-4,7-8,13H,1H3/t7-,8-/m1/s1 |
| InChIKey | WWOIDHPSFRTQNE-HTQZYQBOSA-N |
| XLogP | 1.58 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|