C22H17N5O3 — CID 102245809
7-(2-carbazol-9-ylpyrrolidin-1-yl)-4-nitro-2,1,3-benzoxadiazole (PubChem CID 102245809) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is 7-(2-carbazol-9-ylpyrrolidin-1-yl)-4-nitro-2,1,3-benzoxadiazole.
| Compound Name | 7-(2-carbazol-9-ylpyrrolidin-1-yl)-4-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 102245809 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 7-(2-carbazol-9-ylpyrrolidin-1-yl)-4-nitro-2,1,3-benzoxadiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCCC2n2c3ccccc3c3ccccc32)c2nonc12 |
| InChI | InChI=1S/C22H17N5O3/c28-27(29)19-12-11-18(21-22(19)24-30-23-21)25-13-5-10-20(25)26-16-8-3-1-6-14(16)15-7-2-4-9-17(15)26/h1-4,6-9,11-12,20H,5,10,13H2 |
| InChIKey | AREABRHCZKPVIK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|