C25H29F3O11 — CID 102254248
[(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[[4-(trifluoromethoxy)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(3-oxobutanoyloxy)ethyl] 3-oxobutanoate (PubChem CID 102254248) has the molecular formula C25H29F3O11 and a molecular weight of 562.49 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[[4-(trifluoromethoxy)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(3-oxobutanoyloxy)ethyl] 3-oxobutanoate.
| Compound Name | [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[[4-(trifluoromethoxy)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(3-oxobutanoyloxy)ethyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 102254248 |
| Molecular Formula | C25H29F3O11 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[[4-(trifluoromethoxy)phenyl]methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(3-oxobutanoyloxy)ethyl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC[C@@H](OC(=O)CC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H29F3O11/c1-13(29)9-18(31)33-12-17(35-19(32)10-14(2)30)20-21(22-23(36-20)39-24(3,4)38-22)34-11-15-5-7-16(8-6-15)37-25(26,27)28/h5-8,17,20-23H,9-12H2,1-4H3/t17-,20-,21+,22-,23-/m1/s1 |
| InChIKey | KVVDPQROYDYHKU-LDBVRRDLSA-N |
| XLogP | 2.76 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|