C12H13IO — CID 102255977
(3R,5Z)-6-iodo-6-phenylhexa-1,5-dien-3-ol (PubChem CID 102255977) has the molecular formula C12H13IO and a molecular weight of 300.14 g/mol. Its IUPAC name is (3R,5Z)-6-iodo-6-phenylhexa-1,5-dien-3-ol.
| Compound Name | (3R,5Z)-6-iodo-6-phenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 102255977 |
| Molecular Formula | C12H13IO |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (3R,5Z)-6-iodo-6-phenylhexa-1,5-dien-3-ol |
| SMILES | C=C[C@H](O)C/C=C(\I)c1ccccc1 |
| InChI | InChI=1S/C12H13IO/c1-2-11(14)8-9-12(13)10-6-4-3-5-7-10/h2-7,9,11,14H,1,8H2/b12-9-/t11-/m0/s1 |
| InChIKey | VDYFWTDOXWCSLM-AWPPVZKDSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|