C33H46BrNO6Si — CID 102260365
(4R)-3-benzyl-4-[(4R,5R,6S)-6-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazolidin-2-one (PubChem CID 102260365) has the molecular formula C33H46BrNO6Si and a molecular weight of 660.72 g/mol. Its IUPAC name is (4R)-3-benzyl-4-[(4R,5R,6S)-6-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-benzyl-4-[(4R,5R,6S)-6-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102260365 |
| Molecular Formula | C33H46BrNO6Si |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 659.23 |
| IUPAC Name | (4R)-3-benzyl-4-[(4R,5R,6S)-6-[(E)-3-bromoprop-1-enyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3-oxazolidin-2-one |
| SMILES | CC1(C)O[C@@H](/C=C/CBr)[C@@H](OCc2ccccc2)[C@@H]([C@]2(CO[Si](C)(C)C(C)(C)C)COC(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C33H46BrNO6Si/c1-31(2,3)42(6,7)39-24-33(23-38-30(36)35(33)21-25-15-10-8-11-16-25)29-28(37-22-26-17-12-9-13-18-26)27(19-14-20-34)40-32(4,5)41-29/h8-19,27-29H,20-24H2,1-7H3/b19-14+/t27-,28+,29-,33+/m0/s1 |
| InChIKey | NHIGEFVXPLRXBH-AHPHAJGUSA-N |
| XLogP | 7.46 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|