C19H39O7PSi — CID 102280608
(2R)-2-[(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-6-hydroxy-3-methyloxan-2-yl]propanal (PubChem CID 102280608) has the molecular formula C19H39O7PSi and a molecular weight of 438.57 g/mol. Its IUPAC name is (2R)-2-[(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-6-hydroxy-3-methyloxan-2-yl]propanal.
| Compound Name | (2R)-2-[(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-6-hydroxy-3-methyloxan-2-yl]propanal |
|---|---|
| PubChem CID | 102280608 |
| Molecular Formula | C19H39O7PSi |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2R)-2-[(2R,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-diethoxyphosphoryl-6-hydroxy-3-methyloxan-2-yl]propanal |
| SMILES | CCOP(=O)(OCC)C1(O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]([C@@H](C)C=O)O1 |
| InChI | InChI=1S/C19H39O7PSi/c1-10-23-27(22,24-11-2)19(21)12-16(26-28(8,9)18(5,6)7)15(4)17(25-19)14(3)13-20/h13-17,21H,10-12H2,1-9H3/t14-,15-,16+,17-,19?/m0/s1 |
| InChIKey | JPJICXWKGGMYKW-OOHXRKOZSA-N |
| XLogP | 4.55 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|