C12H18O2 — CID 102302214
trans-(2R,3R)-2-[(Z)-4-hydroxybut-2-enyl]-3-[(E)-prop-1-enyl]cyclopentan-1-one (PubChem CID 102302214) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is trans-(2R,3R)-2-[(Z)-4-hydroxybut-2-enyl]-3-[(E)-prop-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-[(Z)-4-hydroxybut-2-enyl]-3-[(E)-prop-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 102302214 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | trans-(2R,3R)-2-[(Z)-4-hydroxybut-2-enyl]-3-[(E)-prop-1-enyl]cyclopentan-1-one |
| SMILES | C/C=C/[C@H]1CCC(=O)[C@@H]1C/C=C\CO |
| InChI | InChI=1S/C12H18O2/c1-2-5-10-7-8-12(14)11(10)6-3-4-9-13/h2-5,10-11,13H,6-9H2,1H3/b4-3-,5-2+/t10-,11+/m0/s1 |
| InChIKey | FLXIBCORDRESJL-IRKLHNKTSA-N |
| XLogP | 2.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|