C14H10Br2O2Se — CID 102308032
5,5'-dibromo-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] (PubChem CID 102308032) has the molecular formula C14H10Br2O2Se and a molecular weight of 449.00 g/mol. Its IUPAC name is 5,5'-dibromo-1,1'-spirobi[3H-2,1λ4-benzoxaselenole].
| Compound Name | 5,5'-dibromo-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] |
|---|---|
| PubChem CID | 102308032 |
| Molecular Formula | C14H10Br2O2Se |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 447.82 |
| IUPAC Name | 5,5'-dibromo-1,1'-spirobi[3H-2,1λ4-benzoxaselenole] |
| SMILES | Brc1ccc2c(c1)CO[Se]21OCc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H10Br2O2Se/c15-11-1-3-13-9(5-11)7-17-19(13)14-4-2-12(16)6-10(14)8-18-19/h1-6H,7-8H2 |
| InChIKey | JHACKQIPKQMHGR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|