C14H21NO4 — CID 102314762
5-(3,4-dimethoxyphenyl)-2-methoxy-4-methylmorpholine (PubChem CID 102314762) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-2-methoxy-4-methylmorpholine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-2-methoxy-4-methylmorpholine |
|---|---|
| PubChem CID | 102314762 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-2-methoxy-4-methylmorpholine |
| SMILES | COc1ccc(C2COC(OC)CN2C)cc1OC |
| InChI | InChI=1S/C14H21NO4/c1-15-8-14(18-4)19-9-11(15)10-5-6-12(16-2)13(7-10)17-3/h5-7,11,14H,8-9H2,1-4H3 |
| InChIKey | JFOMGMMOKSDUNZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |