C19H36O5Si — CID 102326250
ethyl (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate (PubChem CID 102326250) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is ethyl (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate.
| Compound Name | ethyl (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 102326250 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | ethyl (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O5Si/c1-10-21-16(20)13-14(2)17-15(23-19(6,7)24-17)11-12-22-25(8,9)18(3,4)5/h13,15,17H,10-12H2,1-9H3/b14-13+/t15-,17-/m0/s1 |
| InChIKey | BAMZJJLQRTTXQE-NVOIFWJYSA-N |
| XLogP | 4.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|