C29H33NO3Si — CID 102326390
[(1R,4R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl] pyridine-2-carboxylate (PubChem CID 102326390) has the molecular formula C29H33NO3Si and a molecular weight of 471.67 g/mol. Its IUPAC name is [(1R,4R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl] pyridine-2-carboxylate.
| Compound Name | [(1R,4R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102326390 |
| Molecular Formula | C29H33NO3Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(1R,4R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl] pyridine-2-carboxylate |
| SMILES | CC(C)(C)[Si](OCC[C@H]1C=C[C@H](OC(=O)c2ccccn2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO3Si/c1-29(2,3)34(25-12-6-4-7-13-25,26-14-8-5-9-15-26)32-21-19-23-17-18-24(22-23)33-28(31)27-16-10-11-20-30-27/h4-18,20,23-24H,19,21-22H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | TZVYIPPVUIEMAQ-RPWUZVMVSA-N |
| XLogP | 5.15 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|