C30H40O5Si — CID 135073337
dimethyl 2-[2-[(1S,4S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl]ethyl]propanedioate (PubChem CID 135073337) has the molecular formula C30H40O5Si and a molecular weight of 508.73 g/mol. Its IUPAC name is dimethyl 2-[2-[(1S,4S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[(1S,4S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 135073337 |
| Molecular Formula | C30H40O5Si |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | dimethyl 2-[2-[(1S,4S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopent-2-en-1-yl]ethyl]propanedioate |
| SMILES | COC(=O)C(CC[C@@H]1C=C[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1)C(=O)OC |
| InChI | InChI=1S/C30H40O5Si/c1-30(2,3)36(25-12-8-6-9-13-25,26-14-10-7-11-15-26)35-21-20-24-17-16-23(22-24)18-19-27(28(31)33-4)29(32)34-5/h6-17,23-24,27H,18-22H2,1-5H3/t23-,24+/m0/s1 |
| InChIKey | VKJUSMPUDYYEKB-BJKOFHAPSA-N |
| XLogP | 4.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|