C26H32N2O4Si — CID 66813497
3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-hydroxy-N-pyridin-2-ylpropanamide (PubChem CID 66813497) has the molecular formula C26H32N2O4Si and a molecular weight of 464.64 g/mol. Its IUPAC name is 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-hydroxy-N-pyridin-2-ylpropanamide.
| Compound Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-hydroxy-N-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 66813497 |
| Molecular Formula | C26H32N2O4Si |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2-hydroxy-N-pyridin-2-ylpropanamide |
| SMILES | CC(C)(C)[Si](OCCOCC(O)C(=O)Nc1ccccn1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O4Si/c1-26(2,3)33(21-12-6-4-7-13-21,22-14-8-5-9-15-22)32-19-18-31-20-23(29)25(30)28-24-16-10-11-17-27-24/h4-17,23,29H,18-20H2,1-3H3,(H,27,28,30) |
| InChIKey | FMKULSXWMVCEIL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|