C27H28O6 — CID 102327928
2-phenylmethoxyethyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate (PubChem CID 102327928) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-phenylmethoxyethyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate.
| Compound Name | 2-phenylmethoxyethyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate |
|---|---|
| PubChem CID | 102327928 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-phenylmethoxyethyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate |
| SMILES | CC1(O)OOC(c2ccccc2)(c2ccccc2)CC1C(=O)OCCOCc1ccccc1 |
| InChI | InChI=1S/C27H28O6/c1-26(29)24(25(28)31-18-17-30-20-21-11-5-2-6-12-21)19-27(33-32-26,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,24,29H,17-20H2,1H3 |
| InChIKey | GRVHHBBNRMGFCK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|