C40H40O8 — CID 10841935
4-(5-methyl-2,2-diphenyl-3H-furan-4-carbonyl)oxybutyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate (PubChem CID 10841935) has the molecular formula C40H40O8 and a molecular weight of 648.75 g/mol. Its IUPAC name is 4-(5-methyl-2,2-diphenyl-3H-furan-4-carbonyl)oxybutyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate.
| Compound Name | 4-(5-methyl-2,2-diphenyl-3H-furan-4-carbonyl)oxybutyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate |
|---|---|
| PubChem CID | 10841935 |
| Molecular Formula | C40H40O8 |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | 4-(5-methyl-2,2-diphenyl-3H-furan-4-carbonyl)oxybutyl 3-hydroxy-3-methyl-6,6-diphenyldioxane-4-carboxylate |
| SMILES | CC1=C(C(=O)OCCCCOC(=O)C2CC(c3ccccc3)(c3ccccc3)OOC2(C)O)CC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C40H40O8/c1-29-34(27-39(46-29,30-17-7-3-8-18-30)31-19-9-4-10-20-31)36(41)44-25-15-16-26-45-37(42)35-28-40(48-47-38(35,2)43,32-21-11-5-12-22-32)33-23-13-6-14-24-33/h3-14,17-24,35,43H,15-16,25-28H2,1-2H3 |
| InChIKey | YBHHGFKXCDVSCH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|