C29H30N5P — CID 102337921
bis(3,5-dimethylpyrazol-1-yl)methyl-diphenyl-phenylimino-λ5-phosphane (PubChem CID 102337921) has the molecular formula C29H30N5P and a molecular weight of 479.57 g/mol. Its IUPAC name is bis(3,5-dimethylpyrazol-1-yl)methyl-diphenyl-phenylimino-λ5-phosphane.
| Compound Name | bis(3,5-dimethylpyrazol-1-yl)methyl-diphenyl-phenylimino-λ5-phosphane |
|---|---|
| PubChem CID | 102337921 |
| Molecular Formula | C29H30N5P |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | bis(3,5-dimethylpyrazol-1-yl)methyl-diphenyl-phenylimino-λ5-phosphane |
| SMILES | Cc1cc(C)n(C(n2nc(C)cc2C)P(=Nc2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H30N5P/c1-22-20-24(3)33(30-22)29(34-25(4)21-23(2)31-34)35(27-16-10-6-11-17-27,28-18-12-7-13-19-28)32-26-14-8-5-9-15-26/h5-21,29H,1-4H3 |
| InChIKey | RWEIWUCKDLTUNK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|