C17H17GaN2 — CID 134998652
(3,5-dimethylpyrazol-1-yl)-diphenylgallane (PubChem CID 134998652) has the molecular formula C17H17GaN2 and a molecular weight of 319.06 g/mol. Its IUPAC name is (3,5-dimethylpyrazol-1-yl)-diphenylgallane.
| Compound Name | (3,5-dimethylpyrazol-1-yl)-diphenylgallane |
|---|---|
| PubChem CID | 134998652 |
| Molecular Formula | C17H17GaN2 |
| Molecular Weight | 319.06 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (3,5-dimethylpyrazol-1-yl)-diphenylgallane |
| SMILES | Cc1cc(C)n([Ga](c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/2C6H5.C5H7N2.Ga/c2*1-2-4-6-5-3-1;1-4-3-5(2)7-6-4;/h2*1-5H;3H,1-2H3;/q;;-1;+1 |
| InChIKey | HPNVFIVAQZDZRO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.06 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |