C40H34F6N2O3S — CID 102342522
1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(4S,5R)-5-[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]thiourea (PubChem CID 102342522) has the molecular formula C40H34F6N2O3S and a molecular weight of 736.78 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(4S,5R)-5-[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(4S,5R)-5-[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]thiourea |
|---|---|
| PubChem CID | 102342522 |
| Molecular Formula | C40H34F6N2O3S |
| Molecular Weight | 736.78 g/mol |
| Exact Mass | 736.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[[(4S,5R)-5-[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]thiourea |
| SMILES | CC1(C)O[C@@H](C(O)(c2ccccc2)c2ccccc2)[C@H](C(NC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C40H34F6N2O3S/c1-36(2)50-33(34(51-36)38(49,28-19-11-5-12-20-28)29-21-13-6-14-22-29)37(26-15-7-3-8-16-26,27-17-9-4-10-18-27)48-35(52)47-32-24-30(39(41,42)43)23-31(25-32)40(44,45)46/h3-25,33-34,49H,1-2H3,(H2,47,48,52)/t33-,34-/m1/s1 |
| InChIKey | QOUCTOFWFOWBKR-KKLWWLSJSA-N |
| XLogP | 9.41 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.78 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|