C16H19NO4S — CID 102346179
(4S)-3-[(2S,3S)-3-(4-methoxyphenyl)thiirane-2-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 102346179) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (4S)-3-[(2S,3S)-3-(4-methoxyphenyl)thiirane-2-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3S)-3-(4-methoxyphenyl)thiirane-2-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102346179 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (4S)-3-[(2S,3S)-3-(4-methoxyphenyl)thiirane-2-carbonyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@@H]2S[C@H]2C(=O)N2C(=O)OC[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-9(2)12-8-21-16(19)17(12)15(18)14-13(22-14)10-4-6-11(20-3)7-5-10/h4-7,9,12-14H,8H2,1-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | PMCLZSMUPOKJIN-HZSPNIEDSA-N |
| XLogP | 2.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|