C27H21ClN2O4S2 — CID 102358301
3-O-benzyl 1-O-methyl 2-[(R)-1-benzothiophen-2-yl-[(6-chloro-1,3-benzothiazol-2-yl)amino]methyl]propanedioate (PubChem CID 102358301) has the molecular formula C27H21ClN2O4S2 and a molecular weight of 537.06 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 2-[(R)-1-benzothiophen-2-yl-[(6-chloro-1,3-benzothiazol-2-yl)amino]methyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-methyl 2-[(R)-1-benzothiophen-2-yl-[(6-chloro-1,3-benzothiazol-2-yl)amino]methyl]propanedioate |
|---|---|
| PubChem CID | 102358301 |
| Molecular Formula | C27H21ClN2O4S2 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 2-[(R)-1-benzothiophen-2-yl-[(6-chloro-1,3-benzothiazol-2-yl)amino]methyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OCc1ccccc1)[C@@H](Nc1nc2ccc(Cl)cc2s1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C27H21ClN2O4S2/c1-33-25(31)23(26(32)34-15-16-7-3-2-4-8-16)24(22-13-17-9-5-6-10-20(17)35-22)30-27-29-19-12-11-18(28)14-21(19)36-27/h2-14,23-24H,15H2,1H3,(H,29,30)/t23?,24-/m0/s1 |
| InChIKey | SWEUDDRDQRMLMA-CGAIIQECSA-N |
| XLogP | 6.85 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|