C27H38N2O6Si — CID 102375372
methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]hexanoate (PubChem CID 102375372) has the molecular formula C27H38N2O6Si and a molecular weight of 514.70 g/mol. Its IUPAC name is methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]hexanoate |
|---|---|
| PubChem CID | 102375372 |
| Molecular Formula | C27H38N2O6Si |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[(2-phenyl-2-trimethylsilylethoxy)carbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)OCC(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H38N2O6Si/c1-33-25(30)23(17-11-12-18-28-26(31)34-19-21-13-7-5-8-14-21)29-27(32)35-20-24(36(2,3)4)22-15-9-6-10-16-22/h5-10,13-16,23-24H,11-12,17-20H2,1-4H3,(H,28,31)(H,29,32)/t23-,24?/m0/s1 |
| InChIKey | WUOHHQPSAYCZLG-UXMRNZNESA-N |
| XLogP | 5.01 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|