C34H34N2O2 — CID 102380266
(1R)-1-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-1-phenylethanol (PubChem CID 102380266) has the molecular formula C34H34N2O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is (1R)-1-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-1-phenylethanol.
| Compound Name | (1R)-1-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 102380266 |
| Molecular Formula | C34H34N2O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (1R)-1-[(2R,3S)-3-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1-tritylaziridin-2-yl]-1-phenylethanol |
| SMILES | CC1(C)COC([C@@H]2[C@H]([C@](C)(O)c3ccccc3)N2C(c2ccccc2)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C34H34N2O2/c1-32(2)24-38-31(35-32)29-30(33(3,37)25-16-8-4-9-17-25)36(29)34(26-18-10-5-11-19-26,27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-23,29-30,37H,24H2,1-3H3/t29-,30+,33+,36?/m0/s1 |
| InChIKey | BPEKYCMRPHOUBR-XRWCHPQBSA-N |
| XLogP | 6.15 |
| TPSA | 44.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|