C21H40OSi2 — CID 102384075
tert-butyl-[(1S,2S,3E)-2-ethenyl-2-methyl-3-(1-trimethylsilylbut-3-enylidene)cyclopentyl]oxy-dimethylsilane (PubChem CID 102384075) has the molecular formula C21H40OSi2 and a molecular weight of 364.72 g/mol. Its IUPAC name is tert-butyl-[(1S,2S,3E)-2-ethenyl-2-methyl-3-(1-trimethylsilylbut-3-enylidene)cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S,3E)-2-ethenyl-2-methyl-3-(1-trimethylsilylbut-3-enylidene)cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102384075 |
| Molecular Formula | C21H40OSi2 |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl-[(1S,2S,3E)-2-ethenyl-2-methyl-3-(1-trimethylsilylbut-3-enylidene)cyclopentyl]oxy-dimethylsilane |
| SMILES | C=CC/C(=C1/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C=C)[Si](C)(C)C |
| InChI | InChI=1S/C21H40OSi2/c1-12-14-18(23(7,8)9)17-15-16-19(21(17,6)13-2)22-24(10,11)20(3,4)5/h12-13,19H,1-2,14-16H2,3-11H3/b18-17+/t19-,21-/m0/s1 |
| InChIKey | NRJDIFBUUOKSOY-FEUDMMEASA-N |
| XLogP | 7.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|