C19H25N3O10 — CID 102387243
6-[[carboxy-[2-(6-nitro-1,3-benzodioxol-5-yl)propoxycarbonylamino]methyl]amino]hexanoic acid (PubChem CID 102387243) has the molecular formula C19H25N3O10 and a molecular weight of 455.42 g/mol. Its IUPAC name is 6-[[carboxy-[2-(6-nitro-1,3-benzodioxol-5-yl)propoxycarbonylamino]methyl]amino]hexanoic acid.
| Compound Name | 6-[[carboxy-[2-(6-nitro-1,3-benzodioxol-5-yl)propoxycarbonylamino]methyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 102387243 |
| Molecular Formula | C19H25N3O10 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 6-[[carboxy-[2-(6-nitro-1,3-benzodioxol-5-yl)propoxycarbonylamino]methyl]amino]hexanoic acid |
| SMILES | CC(COC(=O)NC(NCCCCCC(=O)O)C(=O)O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H25N3O10/c1-11(12-7-14-15(32-10-31-14)8-13(12)22(28)29)9-30-19(27)21-17(18(25)26)20-6-4-2-3-5-16(23)24/h7-8,11,17,20H,2-6,9-10H2,1H3,(H,21,27)(H,23,24)(H,25,26) |
| InChIKey | VMLCNENCLQTOTD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 186.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|