C25H33N3O13S — CID 10240144
[4-[(2S,3R,4R,5R)-2-[(2-acetamido-3-methyl-3-nitrososulfanylbutanoyl)amino]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-oxobutyl] 2-acetyloxybenzoate (PubChem CID 10240144) has the molecular formula C25H33N3O13S and a molecular weight of 615.61 g/mol. Its IUPAC name is [4-[(2S,3R,4R,5R)-2-[(2-acetamido-3-methyl-3-nitrososulfanylbutanoyl)amino]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-oxobutyl] 2-acetyloxybenzoate.
| Compound Name | [4-[(2S,3R,4R,5R)-2-[(2-acetamido-3-methyl-3-nitrososulfanylbutanoyl)amino]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-oxobutyl] 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 10240144 |
| Molecular Formula | C25H33N3O13S |
| Molecular Weight | 615.61 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | [4-[(2S,3R,4R,5R)-2-[(2-acetamido-3-methyl-3-nitrososulfanylbutanoyl)amino]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-oxobutyl] 2-acetyloxybenzoate |
| SMILES | CC(=O)NC(C(=O)N[C@]1(OC(=O)CCCOC(=O)c2ccccc2OC(C)=O)O[C@H](CO)[C@H](O)[C@H]1O)C(C)(C)SN=O |
| InChI | InChI=1S/C25H33N3O13S/c1-13(30)26-20(24(3,4)42-28-37)22(35)27-25(21(34)19(33)17(12-29)40-25)41-18(32)10-7-11-38-23(36)15-8-5-6-9-16(15)39-14(2)31/h5-6,8-9,17,19-21,29,33-34H,7,10-12H2,1-4H3,(H,26,30)(H,27,35)/t17-,19+,20?,21-,25+/m1/s1 |
| InChIKey | KQHPGFVIDDKZAS-IJWGYGMZSA-N |
| XLogP | -0.33 |
| TPSA | 236.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.61 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|