C18H19NO3 — CID 102409251
(3aR,4S,9aS)-7-methoxy-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine (PubChem CID 102409251) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3aR,4S,9aS)-7-methoxy-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine.
| Compound Name | (3aR,4S,9aS)-7-methoxy-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine |
|---|---|
| PubChem CID | 102409251 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3aR,4S,9aS)-7-methoxy-N-phenyl-3,3a,4,9a-tetrahydro-2H-furo[2,3-b]chromen-4-amine |
| SMILES | COc1ccc2c(c1)O[C@@H]1OCC[C@@H]1[C@@H]2Nc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-20-13-7-8-14-16(11-13)22-18-15(9-10-21-18)17(14)19-12-5-3-2-4-6-12/h2-8,11,15,17-19H,9-10H2,1H3/t15-,17-,18+/m1/s1 |
| InChIKey | IKUBASGLONMEIL-NXHRZFHOSA-N |
| XLogP | 3.60 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |