C20H26B2N2O6 — CID 102413424
2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]oxazolo[5,4-f][1,3]benzoxazole (PubChem CID 102413424) has the molecular formula C20H26B2N2O6 and a molecular weight of 412.06 g/mol. Its IUPAC name is 2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]oxazolo[5,4-f][1,3]benzoxazole.
| Compound Name | 2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 102413424 |
| Molecular Formula | C20H26B2N2O6 |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2,6-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| SMILES | CC1(C)OB(c2nc3cc4oc(B5OC(C)(C)C(C)(C)O5)nc4cc3o2)OC1(C)C |
| InChI | InChI=1S/C20H26B2N2O6/c1-17(2)18(3,4)28-21(27-17)15-23-11-9-14-12(10-13(11)25-15)24-16(26-14)22-29-19(5,6)20(7,8)30-22/h9-10H,1-8H3 |
| InChIKey | FGZPXVUJYLPHKP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|