C8H4F4N6 — CID 102418521
1-[3,3,4,4-tetrafluoro-2-(1,2,4-triazol-4-yl)cyclobuten-1-yl]-1,2,4-triazole (PubChem CID 102418521) has the molecular formula C8H4F4N6 and a molecular weight of 260.15 g/mol. Its IUPAC name is 1-[3,3,4,4-tetrafluoro-2-(1,2,4-triazol-4-yl)cyclobuten-1-yl]-1,2,4-triazole.
| Compound Name | 1-[3,3,4,4-tetrafluoro-2-(1,2,4-triazol-4-yl)cyclobuten-1-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 102418521 |
| Molecular Formula | C8H4F4N6 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-[3,3,4,4-tetrafluoro-2-(1,2,4-triazol-4-yl)cyclobuten-1-yl]-1,2,4-triazole |
| SMILES | FC1(F)C(n2cnnc2)=C(n2cncn2)C1(F)F |
| InChI | InChI=1S/C8H4F4N6/c9-7(10)5(17-3-14-15-4-17)6(8(7,11)12)18-2-13-1-16-18/h1-4H |
| InChIKey | DVTAFKUUVOYMBF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|