C28H31NO4SSi — CID 102419020
N-[(R)-[(2S)-3-[dimethyl(phenyl)silyl]-2-ethyl-5-oxofuran-2-yl]-phenylmethyl]-4-methylbenzenesulfonamide (PubChem CID 102419020) has the molecular formula C28H31NO4SSi and a molecular weight of 505.71 g/mol. Its IUPAC name is N-[(R)-[(2S)-3-[dimethyl(phenyl)silyl]-2-ethyl-5-oxofuran-2-yl]-phenylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-[(2S)-3-[dimethyl(phenyl)silyl]-2-ethyl-5-oxofuran-2-yl]-phenylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102419020 |
| Molecular Formula | C28H31NO4SSi |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[(R)-[(2S)-3-[dimethyl(phenyl)silyl]-2-ethyl-5-oxofuran-2-yl]-phenylmethyl]-4-methylbenzenesulfonamide |
| SMILES | CC[C@@]1([C@H](NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)OC(=O)C=C1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4SSi/c1-5-28(25(20-26(30)33-28)35(3,4)24-14-10-7-11-15-24)27(22-12-8-6-9-13-22)29-34(31,32)23-18-16-21(2)17-19-23/h6-20,27,29H,5H2,1-4H3/t27-,28-/m1/s1 |
| InChIKey | HUGJGXUVCZNXHH-VSGBNLITSA-N |
| XLogP | 4.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|