C14H20O10 — CID 102425853
dimethyl (2R,4S,5S,6S)-4,5-diacetyloxy-2-methoxyoxane-2,6-dicarboxylate (PubChem CID 102425853) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is dimethyl (2R,4S,5S,6S)-4,5-diacetyloxy-2-methoxyoxane-2,6-dicarboxylate.
| Compound Name | dimethyl (2R,4S,5S,6S)-4,5-diacetyloxy-2-methoxyoxane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102425853 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | dimethyl (2R,4S,5S,6S)-4,5-diacetyloxy-2-methoxyoxane-2,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1O[C@@](OC)(C(=O)OC)C[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O10/c1-7(15)22-9-6-14(21-5,13(18)20-4)24-11(12(17)19-3)10(9)23-8(2)16/h9-11H,6H2,1-5H3/t9-,10-,11-,14+/m0/s1 |
| InChIKey | YZOMCUOQFFDIOP-AYGWYOGXSA-N |
| XLogP | -0.67 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|