C20H40OSi — CID 102429051
[(1E,3E)-5-methoxydeca-1,3-dienyl]-tri(propan-2-yl)silane (PubChem CID 102429051) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is [(1E,3E)-5-methoxydeca-1,3-dienyl]-tri(propan-2-yl)silane.
| Compound Name | [(1E,3E)-5-methoxydeca-1,3-dienyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102429051 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | [(1E,3E)-5-methoxydeca-1,3-dienyl]-tri(propan-2-yl)silane |
| SMILES | CCCCCC(/C=C/C=C/[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C20H40OSi/c1-9-10-11-14-20(21-8)15-12-13-16-22(17(2)3,18(4)5)19(6)7/h12-13,15-20H,9-11,14H2,1-8H3/b15-12+,16-13+ |
| InChIKey | UTUVSGLPHOJYGX-WSGPNKEYSA-N |
| XLogP | 6.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|