C4H2N8O6 — CID 102429331
1-hydroxy-5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole (PubChem CID 102429331) has the molecular formula C4H2N8O6 and a molecular weight of 258.11 g/mol. Its IUPAC name is 1-hydroxy-5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole.
| Compound Name | 1-hydroxy-5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 102429331 |
| Molecular Formula | C4H2N8O6 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 1-hydroxy-5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(-c2nc([N+](=O)[O-])nn2O)n(O)n1 |
| InChI | InChI=1S/C4H2N8O6/c13-9-1(5-3(7-9)11(15)16)2-6-4(12(17)18)8-10(2)14/h13-14H |
| InChIKey | PYRPPLLDGRNCTN-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 188.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|