C14H14O9 — CID 10245810
methyl (1R,4R,7R,8R,11S,15R)-7-hydroxy-11-methyl-2,10-dioxo-3,9,12,14-tetraoxatetracyclo[6.5.2.01,11.04,15]pentadec-5-ene-5-carboxylate (PubChem CID 10245810) has the molecular formula C14H14O9 and a molecular weight of 326.26 g/mol. Its IUPAC name is methyl (1R,4R,7R,8R,11S,15R)-7-hydroxy-11-methyl-2,10-dioxo-3,9,12,14-tetraoxatetracyclo[6.5.2.01,11.04,15]pentadec-5-ene-5-carboxylate.
| Compound Name | methyl (1R,4R,7R,8R,11S,15R)-7-hydroxy-11-methyl-2,10-dioxo-3,9,12,14-tetraoxatetracyclo[6.5.2.01,11.04,15]pentadec-5-ene-5-carboxylate |
|---|---|
| PubChem CID | 10245810 |
| Molecular Formula | C14H14O9 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | methyl (1R,4R,7R,8R,11S,15R)-7-hydroxy-11-methyl-2,10-dioxo-3,9,12,14-tetraoxatetracyclo[6.5.2.01,11.04,15]pentadec-5-ene-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O)[C@H]2OC(=O)[C@@]3(C)OC[C@@]34O[C@@H]2[C@@H]1OC4=O |
| InChI | InChI=1S/C14H14O9/c1-13-11(17)22-8-6(15)3-5(10(16)19-2)7-9(8)23-14(13,4-20-13)12(18)21-7/h3,6-9,15H,4H2,1-2H3/t6-,7-,8-,9-,13-,14+/m1/s1 |
| InChIKey | VMAYLJRWPMGHOI-NGRDJCNTSA-N |
| XLogP | -1.78 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|