C33H40O6S — CID 102476765
(E)-1-hydroxy-10-(4-methylphenyl)sulfonyl-7,7-bis(phenylmethoxymethyl)dec-9-en-5-one (PubChem CID 102476765) has the molecular formula C33H40O6S and a molecular weight of 564.74 g/mol. Its IUPAC name is (E)-1-hydroxy-10-(4-methylphenyl)sulfonyl-7,7-bis(phenylmethoxymethyl)dec-9-en-5-one.
| Compound Name | (E)-1-hydroxy-10-(4-methylphenyl)sulfonyl-7,7-bis(phenylmethoxymethyl)dec-9-en-5-one |
|---|---|
| PubChem CID | 102476765 |
| Molecular Formula | C33H40O6S |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (E)-1-hydroxy-10-(4-methylphenyl)sulfonyl-7,7-bis(phenylmethoxymethyl)dec-9-en-5-one |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/CC(COCc2ccccc2)(COCc2ccccc2)CC(=O)CCCCO)cc1 |
| InChI | InChI=1S/C33H40O6S/c1-28-16-18-32(19-17-28)40(36,37)22-10-20-33(23-31(35)15-8-9-21-34,26-38-24-29-11-4-2-5-12-29)27-39-25-30-13-6-3-7-14-30/h2-7,10-14,16-19,22,34H,8-9,15,20-21,23-27H2,1H3/b22-10+ |
| InChIKey | DQJLYYRTDSJFCH-LSHDLFTRSA-N |
| XLogP | 6.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|