C38H39N4O8P — CID 102482121
1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(3-pyridin-2-yl-1,3,2-oxazaphospholidin-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 102482121) has the molecular formula C38H39N4O8P and a molecular weight of 710.72 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(3-pyridin-2-yl-1,3,2-oxazaphospholidin-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(3-pyridin-2-yl-1,3,2-oxazaphospholidin-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102482121 |
| Molecular Formula | C38H39N4O8P |
| Molecular Weight | 710.72 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[(3-pyridin-2-yl-1,3,2-oxazaphospholidin-2-yl)oxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2OP2OCCN2c2ccccn2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H39N4O8P/c1-26-24-41(37(44)40-36(26)43)35-23-32(50-51-42(21-22-48-51)34-11-7-8-20-39-34)33(49-35)25-47-38(27-9-5-4-6-10-27,28-12-16-30(45-2)17-13-28)29-14-18-31(46-3)19-15-29/h4-20,24,32-33,35H,21-23,25H2,1-3H3,(H,40,43,44)/t32-,33+,35+,51?/m0/s1 |
| InChIKey | DEBRGPRBQMDNSI-WKZJRUATSA-N |
| XLogP | 5.70 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|