C35H36N4O3 — CID 102485048
N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-(phenylcarbamoylamino)benzamide (PubChem CID 102485048) has the molecular formula C35H36N4O3 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-(phenylcarbamoylamino)benzamide.
| Compound Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 102485048 |
| Molecular Formula | C35H36N4O3 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N-benzyl-N-[2-(cyclohexylamino)-2-oxo-1-phenylethyl]-2-(phenylcarbamoylamino)benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccccc1C(=O)N(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C35H36N4O3/c40-33(36-28-19-9-3-10-20-28)32(27-17-7-2-8-18-27)39(25-26-15-5-1-6-16-26)34(41)30-23-13-14-24-31(30)38-35(42)37-29-21-11-4-12-22-29/h1-2,4-8,11-18,21-24,28,32H,3,9-10,19-20,25H2,(H,36,40)(H2,37,38,42) |
| InChIKey | HCVPLYHEIRCDTP-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |