C48H48N9O12P3 — CID 102502669
2-N,2-N',4-N,4-N',6-N,6-N'-hexakis(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine (PubChem CID 102502669) has the molecular formula C48H48N9O12P3 and a molecular weight of 1035.88 g/mol. Its IUPAC name is 2-N,2-N',4-N,4-N',6-N,6-N'-hexakis(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine.
| Compound Name | 2-N,2-N',4-N,4-N',6-N,6-N'-hexakis(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine |
|---|---|
| PubChem CID | 102502669 |
| Molecular Formula | C48H48N9O12P3 |
| Molecular Weight | 1035.88 g/mol |
| Exact Mass | 1035.26 |
| IUPAC Name | 2-N,2-N',4-N,4-N',6-N,6-N'-hexakis(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2,4,4,6,6-hexamine |
| SMILES | c1cc2c(cc1NP1(Nc3ccc4c(c3)OCCO4)=NP(Nc3ccc4c(c3)OCCO4)(Nc3ccc4c(c3)OCCO4)=NP(Nc3ccc4c(c3)OCCO4)(Nc3ccc4c(c3)OCCO4)=N1)OCCO2 |
| InChI | InChI=1S/C48H48N9O12P3/c1-7-37-43(64-19-13-58-37)25-31(1)49-70(50-32-2-8-38-44(26-32)65-20-14-59-38)55-71(51-33-3-9-39-45(27-33)66-21-15-60-39,52-34-4-10-40-46(28-34)67-22-16-61-40)57-72(56-70,53-35-5-11-41-47(29-35)68-23-17-62-41)54-36-6-12-42-48(30-36)69-24-18-63-42/h1-12,25-30,49-54H,13-24H2 |
| InChIKey | IJSJTNVOKHFIQY-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 220.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.88 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|