C25H34O7 — CID 10252994
methyl 4-[(1S)-1-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]benzoate (PubChem CID 10252994) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]benzoate |
|---|---|
| PubChem CID | 10252994 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl 4-[(1S)-1-[[(1R,4S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)O[C@H]2O[C@@H]3O[C@@]4(C)CC[C@H]5[C@H](C)CCC([C@H]2C)[C@@]35OO4)cc1 |
| InChI | InChI=1S/C25H34O7/c1-14-6-11-20-15(2)22(28-16(3)17-7-9-18(10-8-17)21(26)27-5)29-23-25(20)19(14)12-13-24(4,30-23)31-32-25/h7-10,14-16,19-20,22-23H,6,11-13H2,1-5H3/t14-,15-,16+,19+,20?,22+,23-,24-,25-/m1/s1 |
| InChIKey | GEJRUAFBQGUAGN-GGQQOQRQSA-N |
| XLogP | 4.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|