C19H21ClF3N3O2S — CID 10253067
N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-2-pentylsulfinylpyridine-3-carboxamide (PubChem CID 10253067) has the molecular formula C19H21ClF3N3O2S and a molecular weight of 447.91 g/mol. Its IUPAC name is N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-2-pentylsulfinylpyridine-3-carboxamide.
| Compound Name | N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-2-pentylsulfinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10253067 |
| Molecular Formula | C19H21ClF3N3O2S |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]-2-pentylsulfinylpyridine-3-carboxamide |
| SMILES | CCCCCS(=O)c1ncccc1C(=O)NCCc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C19H21ClF3N3O2S/c1-2-3-4-10-29(28)18-14(6-5-8-25-18)17(27)24-9-7-16-15(20)11-13(12-26-16)19(21,22)23/h5-6,8,11-12H,2-4,7,9-10H2,1H3,(H,24,27) |
| InChIKey | DSMSVSUNYOWTNN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|