C31H58O4SSi — CID 10257105
S-tert-butyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6,8,10-tetramethyl-12-methylidene-9-oxotetradec-6-enethioate (PubChem CID 10257105) has the molecular formula C31H58O4SSi and a molecular weight of 554.95 g/mol. Its IUPAC name is S-tert-butyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6,8,10-tetramethyl-12-methylidene-9-oxotetradec-6-enethioate.
| Compound Name | S-tert-butyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6,8,10-tetramethyl-12-methylidene-9-oxotetradec-6-enethioate |
|---|---|
| PubChem CID | 10257105 |
| Molecular Formula | C31H58O4SSi |
| Molecular Weight | 554.95 g/mol |
| Exact Mass | 554.38 |
| IUPAC Name | S-tert-butyl (E,2S,3S,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-3-hydroxy-4,6,8,10-tetramethyl-12-methylidene-9-oxotetradec-6-enethioate |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@H](C)[C@H](O)[C@H](CC)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C31H58O4SSi/c1-16-21(4)28(35-37(14,15)31(11,12)13)24(7)26(32)22(5)18-20(3)19-23(6)27(33)25(17-2)29(34)36-30(8,9)10/h18,22-25,27-28,33H,4,16-17,19H2,1-3,5-15H3/b20-18+/t22-,23+,24-,25+,27+,28-/m1/s1 |
| InChIKey | DVXQRISPZLZJHJ-COZCUYRJSA-N |
| XLogP | 8.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.95 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|