C18H31N2O7P — CID 102576943
propan-2-yl N-[(1E)-1-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-3-methylbuta-1,3-dien-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 102576943) has the molecular formula C18H31N2O7P and a molecular weight of 418.43 g/mol. Its IUPAC name is propan-2-yl N-[(1E)-1-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-3-methylbuta-1,3-dien-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-[(1E)-1-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-3-methylbuta-1,3-dien-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102576943 |
| Molecular Formula | C18H31N2O7P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | propan-2-yl N-[(1E)-1-(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)-3-methylbuta-1,3-dien-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | C=C(C)/C(=C\[P+]1([O-])OCC(C)(C)CO1)N(NC(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C18H31N2O7P/c1-12(2)15(9-28(23)24-10-18(7,8)11-25-28)20(17(22)27-14(5)6)19-16(21)26-13(3)4/h9,13-14H,1,10-11H2,2-8H3,(H,19,21)/b15-9+ |
| InChIKey | NJQIIDFSXDVUSW-OQLLNIDSSA-N |
| XLogP | 3.50 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|