C12H21O7P — CID 122208021
[3-[(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)oxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 122208021) has the molecular formula C12H21O7P and a molecular weight of 308.27 g/mol. Its IUPAC name is [3-[(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)oxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)oxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122208021 |
| Molecular Formula | C12H21O7P |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [3-[(5,5-dimethyl-2-oxido-1,3,2-dioxaphosphinan-2-ium-2-yl)oxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CO[P+]1([O-])OCC(C)(C)CO1 |
| InChI | InChI=1S/C12H21O7P/c1-9(2)11(14)16-5-10(13)6-17-20(15)18-7-12(3,4)8-19-20/h10,13H,1,5-8H2,2-4H3 |
| InChIKey | IVLRSBCCYNWESL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|