C16H15NO — CID 102577789
(3E)-2-benzoyl-2-prop-2-enylhexa-3,5-dienenitrile (PubChem CID 102577789) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (3E)-2-benzoyl-2-prop-2-enylhexa-3,5-dienenitrile.
| Compound Name | (3E)-2-benzoyl-2-prop-2-enylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 102577789 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3E)-2-benzoyl-2-prop-2-enylhexa-3,5-dienenitrile |
| SMILES | C=C/C=C/C(C#N)(CC=C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-3-5-12-16(13-17,11-4-2)15(18)14-9-7-6-8-10-14/h3-10,12H,1-2,11H2/b12-5+ |
| InChIKey | SKNFCZSRFZMOIK-LFYBBSHMSA-N |
| XLogP | 3.70 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|