C31H44N2O3Si — CID 102580764
[[(2S)-1-[(3R,4R,4aR)-1-oxido-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-3H-2,1-benzoxazin-1-ium-3-yl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane (PubChem CID 102580764) has the molecular formula C31H44N2O3Si and a molecular weight of 520.79 g/mol. Its IUPAC name is [[(2S)-1-[(3R,4R,4aR)-1-oxido-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-3H-2,1-benzoxazin-1-ium-3-yl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane.
| Compound Name | [[(2S)-1-[(3R,4R,4aR)-1-oxido-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-3H-2,1-benzoxazin-1-ium-3-yl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102580764 |
| Molecular Formula | C31H44N2O3Si |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | [[(2S)-1-[(3R,4R,4aR)-1-oxido-4-propan-2-yl-4,4a,5,6,7,8-hexahydro-3H-2,1-benzoxazin-1-ium-3-yl]pyrrolidin-2-yl]-diphenylmethoxy]-trimethylsilane |
| SMILES | CC(C)[C@H]1[C@H](N2CCC[C@H]2C(O[Si](C)(C)C)(c2ccccc2)c2ccccc2)O[N+]([O-])=C2CCCC[C@@H]21 |
| InChI | InChI=1S/C31H44N2O3Si/c1-23(2)29-26-19-12-13-20-27(26)33(34)35-30(29)32-22-14-21-28(32)31(36-37(3,4)5,24-15-8-6-9-16-24)25-17-10-7-11-18-25/h6-11,15-18,23,26,28-30H,12-14,19-22H2,1-5H3/t26-,28-,29+,30+/m0/s1 |
| InChIKey | KFBIFIKTWVMDNX-ZYVKACNBSA-N |
| XLogP | 6.93 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|