C26H28O3 — CID 102589015
(E,1S,3S)-5-[4-(methoxymethoxymethyl)phenyl]-1,3-diphenylpent-4-en-1-ol (PubChem CID 102589015) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (E,1S,3S)-5-[4-(methoxymethoxymethyl)phenyl]-1,3-diphenylpent-4-en-1-ol.
| Compound Name | (E,1S,3S)-5-[4-(methoxymethoxymethyl)phenyl]-1,3-diphenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 102589015 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (E,1S,3S)-5-[4-(methoxymethoxymethyl)phenyl]-1,3-diphenylpent-4-en-1-ol |
| SMILES | COCOCc1ccc(/C=C/[C@H](C[C@H](O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O3/c1-28-20-29-19-22-14-12-21(13-15-22)16-17-25(23-8-4-2-5-9-23)18-26(27)24-10-6-3-7-11-24/h2-17,25-27H,18-20H2,1H3/b17-16+/t25-,26+/m1/s1 |
| InChIKey | NCLCVRYODXHMAQ-JXOUXBMHSA-N |
| XLogP | 5.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|